C30H20Cl4N2O3 — CID 3575829
3-(2,6-dichlorophenyl)-N-[4-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenoxy]phenyl]prop-2-enamide (PubChem CID 3575829) has the molecular formula C30H20Cl4N2O3 and a molecular weight of 598.31 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[4-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenoxy]phenyl]prop-2-enamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[4-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3575829 |
| Molecular Formula | C30H20Cl4N2O3 |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[4-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenoxy]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1c(Cl)cccc1Cl)Nc1ccc(Oc2ccc(NC(=O)C=Cc3c(Cl)cccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C30H20Cl4N2O3/c31-25-3-1-4-26(32)23(25)15-17-29(37)35-19-7-11-21(12-8-19)39-22-13-9-20(10-14-22)36-30(38)18-16-24-27(33)5-2-6-28(24)34/h1-18H,(H,35,37)(H,36,38) |
| InChIKey | RDEUKJWICYMWSF-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|