C15H9Cl3FNO — CID 6105621
(E)-3-(2-chloro-6-fluorophenyl)-N-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 6105621) has the molecular formula C15H9Cl3FNO and a molecular weight of 344.60 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6105621 |
| Molecular Formula | C15H9Cl3FNO |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl3FNO/c16-11-2-1-3-14(19)10(11)5-7-15(21)20-9-4-6-12(17)13(18)8-9/h1-8H,(H,20,21)/b7-5+ |
| InChIKey | AMHPXMYXKVYEOH-FNORWQNLSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|