C16H12Cl2FNO — CID 6031428
(E)-3-(2-chloro-6-fluorophenyl)-N-(3-chloro-4-methylphenyl)prop-2-enamide (PubChem CID 6031428) has the molecular formula C16H12Cl2FNO and a molecular weight of 324.18 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(3-chloro-4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3-chloro-4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6031428 |
| Molecular Formula | C16H12Cl2FNO |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3-chloro-4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2FNO/c1-10-5-6-11(9-14(10)18)20-16(21)8-7-12-13(17)3-2-4-15(12)19/h2-9H,1H3,(H,20,21)/b8-7+ |
| InChIKey | RSXWXGWISXENRV-BQYQJAHWSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|