C18H17ClFNO4 — CID 27666802
(E)-3-(2-chloro-6-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 27666802) has the molecular formula C18H17ClFNO4 and a molecular weight of 365.79 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27666802 |
| Molecular Formula | C18H17ClFNO4 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2c(F)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClFNO4/c1-23-15-9-11(10-16(24-2)18(15)25-3)21-17(22)8-7-12-13(19)5-4-6-14(12)20/h4-10H,1-3H3,(H,21,22)/b8-7+ |
| InChIKey | AKDPVPNGVGXVCE-BQYQJAHWSA-N |
| XLogP | 4.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|