C19H18ClFN2O5 — CID 9273647
N'-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 9273647) has the molecular formula C19H18ClFN2O5 and a molecular weight of 408.81 g/mol. Its IUPAC name is N'-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 9273647 |
| Molecular Formula | C19H18ClFN2O5 |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N'-[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)/C=C/c2c(F)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H18ClFN2O5/c1-26-15-9-11(10-16(27-2)18(15)28-3)19(25)23-22-17(24)8-7-12-13(20)5-4-6-14(12)21/h4-10H,1-3H3,(H,22,24)(H,23,25)/b8-7+ |
| InChIKey | XBHOMUSAWDJQAJ-BQYQJAHWSA-N |
| XLogP | 2.98 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|