C20H22N2O6 — CID 7948325
4-methoxy-N'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 7948325) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 4-methoxy-N'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 7948325 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-methoxy-N'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-25-15-8-6-14(7-9-15)20(24)22-21-18(23)10-5-13-11-16(26-2)19(28-4)17(12-13)27-3/h5-12H,1-4H3,(H,21,23)(H,22,24)/b10-5+ |
| InChIKey | ZBURYEXKNLKJDU-BJMVGYQFSA-N |
| XLogP | 2.20 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|