C30H33NO8 — CID 135360201
(E)-N-[5-methoxy-2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 135360201) has the molecular formula C30H33NO8 and a molecular weight of 535.59 g/mol. Its IUPAC name is (E)-N-[5-methoxy-2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-methoxy-2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135360201 |
| Molecular Formula | C30H33NO8 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (E)-N-[5-methoxy-2-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)c(NC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C30H33NO8/c1-33-22-12-11-21(10-8-19-14-24(34-2)29(38-6)25(15-19)35-3)23(18-22)31-28(32)13-9-20-16-26(36-4)30(39-7)27(17-20)37-5/h8-18H,1-7H3,(H,31,32)/b10-8+,13-9+ |
| InChIKey | MWVXAFUBTPATDN-IAQVKYGWSA-N |
| XLogP | 5.57 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|