C30H31NO6 — CID 134197466
(E)-N-[5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 134197466) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is (E)-N-[5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 134197466 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (E)-N-[5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1cccc(/C=C/C(=O)Nc2cc(OC)ccc2C=Cc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C30H31NO6/c1-6-16-37-25-9-7-8-21(17-25)11-15-29(32)31-26-20-24(33-2)14-13-23(26)12-10-22-18-27(34-3)30(36-5)28(19-22)35-4/h6-15,17-20H,1,16H2,2-5H3,(H,31,32)/b12-10?,15-11+ |
| InChIKey | GKBRSRZOLUOLNV-IKHRNXKKSA-N |
| XLogP | 6.11 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|