C29H29NO5 — CID 135359781
(E)-3-(3-prop-2-enoxyphenyl)-N-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359781) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is (E)-3-(3-prop-2-enoxyphenyl)-N-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-prop-2-enoxyphenyl)-N-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359781 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (E)-3-(3-prop-2-enoxyphenyl)-N-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | C=CCOc1cccc(/C=C/C(=O)Nc2ccccc2C=Cc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H29NO5/c1-5-17-35-24-11-8-9-21(18-24)14-16-28(31)30-25-12-7-6-10-23(25)15-13-22-19-26(32-2)29(34-4)27(20-22)33-3/h5-16,18-20H,1,17H2,2-4H3,(H,30,31)/b15-13?,16-14+ |
| InChIKey | OHZJTTTWKLDRQH-GEHMZHQGSA-N |
| XLogP | 6.10 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|