C18H18N2O5 — CID 118712438
N'-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 118712438) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N'-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 118712438 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N'-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | COc1cc(/C=C/C(=O)NNC(=O)c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C18H18N2O5/c1-24-14-10-12(11-15(25-2)17(14)22)8-9-16(21)19-20-18(23)13-6-4-3-5-7-13/h3-11,22H,1-2H3,(H,19,21)(H,20,23)/b9-8+ |
| InChIKey | NGRUWMBIDJTNLR-CMDGGOBGSA-N |
| XLogP | 1.88 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|