C22H27N3O4 — CID 4219280
4-(diethylamino)-N'-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 4219280) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 4219280 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-(diethylamino)-N'-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)C=Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-5-25(6-2)18-11-9-17(10-12-18)22(27)24-23-21(26)14-8-16-7-13-19(28-3)20(15-16)29-4/h7-15H,5-6H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | WVVRHYPHOBRPNM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|