C19H19ClFNO — CID 6282453
(E)-N-(4-butan-2-ylphenyl)-3-(2-chloro-6-fluorophenyl)prop-2-enamide (PubChem CID 6282453) has the molecular formula C19H19ClFNO and a molecular weight of 331.82 g/mol. Its IUPAC name is (E)-N-(4-butan-2-ylphenyl)-3-(2-chloro-6-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-butan-2-ylphenyl)-3-(2-chloro-6-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6282453 |
| Molecular Formula | C19H19ClFNO |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (E)-N-(4-butan-2-ylphenyl)-3-(2-chloro-6-fluorophenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccc(NC(=O)/C=C/c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClFNO/c1-3-13(2)14-7-9-15(10-8-14)22-19(23)12-11-16-17(20)5-4-6-18(16)21/h4-13H,3H2,1-2H3,(H,22,23)/b12-11+ |
| InChIKey | FYICAXRDIGRULK-VAWYXSNFSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|