C16H13Cl2NO — CID 732081
3-(2,6-dichlorophenyl)-N-(3-methylphenyl)prop-2-enamide (PubChem CID 732081) has the molecular formula C16H13Cl2NO and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 732081 |
| Molecular Formula | C16H13Cl2NO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C=Cc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO/c1-11-4-2-5-12(10-11)19-16(20)9-8-13-14(17)6-3-7-15(13)18/h2-10H,1H3,(H,19,20) |
| InChIKey | MHOPKKLOWVRALE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|