C17H14Cl2N2O3 — CID 55804764
methyl N-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenyl]carbamate (PubChem CID 55804764) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is methyl N-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenyl]carbamate.
| Compound Name | methyl N-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 55804764 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl N-[4-[3-(2,6-dichlorophenyl)prop-2-enoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)C=Cc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-24-17(23)21-12-7-5-11(6-8-12)20-16(22)10-9-13-14(18)3-2-4-15(13)19/h2-10H,1H3,(H,20,22)(H,21,23) |
| InChIKey | POVIZPFWHFDUPH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|