C14H10Cl2N2O — CID 5211022
3-(2,6-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide (PubChem CID 5211022) has the molecular formula C14H10Cl2N2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 5211022 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1c(Cl)cccc1Cl)Nc1cccnc1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-12-4-1-5-13(16)11(12)6-7-14(19)18-10-3-2-8-17-9-10/h1-9H,(H,18,19) |
| InChIKey | ZBIPXSGGLMSHJX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|