C24H18N2O4 — CID 40888792
N-[4-(1,3-benzoxazol-2-yl)phenyl]-7-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 40888792) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-7-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-7-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40888792 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-7-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)Nc3ccc(-c4nc5ccccc5o4)cc3)oc12 |
| InChI | InChI=1S/C24H18N2O4/c1-2-28-20-9-5-6-16-14-21(29-22(16)20)23(27)25-17-12-10-15(11-13-17)24-26-18-7-3-4-8-19(18)30-24/h3-14H,2H2,1H3,(H,25,27) |
| InChIKey | PVKUEOARBCYQCK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |