C18H11IN2O3 — CID 15999485
N-[4-(1,3-benzoxazol-2-yl)phenyl]-5-iodofuran-2-carboxamide (PubChem CID 15999485) has the molecular formula C18H11IN2O3 and a molecular weight of 430.20 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-5-iodofuran-2-carboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-5-iodofuran-2-carboxamide |
|---|---|
| PubChem CID | 15999485 |
| Molecular Formula | C18H11IN2O3 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-5-iodofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(I)o1 |
| InChI | InChI=1S/C18H11IN2O3/c19-16-10-9-15(23-16)17(22)20-12-7-5-11(6-8-12)18-21-13-3-1-2-4-14(13)24-18/h1-10H,(H,20,22) |
| InChIKey | MVPVGAQRSWPYAT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|