C21H13F3N2O3 — CID 16580992
N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(trifluoromethoxy)benzamide (PubChem CID 16580992) has the molecular formula C21H13F3N2O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 16580992 |
| Molecular Formula | C21H13F3N2O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13F3N2O3/c22-21(23,24)29-16-11-7-13(8-12-16)19(27)25-15-9-5-14(6-10-15)20-26-17-3-1-2-4-18(17)28-20/h1-12H,(H,25,27) |
| InChIKey | UHOQAGKWWLYNCI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |