C18H17N3O2S — CID 17099655
N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 17099655) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 17099655 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(=S)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H17N3O2S/c1-11(2)16(22)21-18(24)19-13-9-7-12(8-10-13)17-20-14-5-3-4-6-15(14)23-17/h3-11H,1-2H3,(H2,19,21,22,24) |
| InChIKey | ZMFZXGOLTJOXIC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|