C29H24N4O2S2 — CID 19316319
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 19316319) has the molecular formula C29H24N4O2S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316319 |
| Molecular Formula | C29H24N4O2S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C29H24N4O2S2/c1-19(37-24-11-7-10-23(18-24)32-29(36)31-21-8-3-2-4-9-21)27(34)30-22-16-14-20(15-17-22)28-33-25-12-5-6-13-26(25)35-28/h2-19H,1H3,(H,30,34)(H2,31,32,36) |
| InChIKey | XEIUGJMTGPNVBU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|