C17H16N4O2S — CID 2993852
2-methyl-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide (PubChem CID 2993852) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-methyl-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide.
| Compound Name | 2-methyl-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 2993852 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-methyl-N-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide |
| SMILES | CC(C)C(=O)NC(=S)Nc1ccc(-c2nc3ncccc3o2)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-10(2)15(22)21-17(24)19-12-7-5-11(6-8-12)16-20-14-13(23-16)4-3-9-18-14/h3-10H,1-2H3,(H2,19,21,22,24) |
| InChIKey | HQMUJARSCSJPEA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|