C27H20N4O2S — CID 1048116
N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 1048116) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1048116 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3ncccc3o2)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20N4O2S/c32-25(23(18-9-3-1-4-10-18)19-11-5-2-6-12-19)31-27(34)29-21-14-7-13-20(17-21)26-30-24-22(33-26)15-8-16-28-24/h1-17,23H,(H2,29,31,32,34) |
| InChIKey | ZOFIRGNSSNILGJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|