C19H12IN3O2 — CID 1215765
4-iodo-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 1215765) has the molecular formula C19H12IN3O2 and a molecular weight of 441.23 g/mol. Its IUPAC name is 4-iodo-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 4-iodo-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1215765 |
| Molecular Formula | C19H12IN3O2 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 4-iodo-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ncccc3o2)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H12IN3O2/c20-14-8-6-12(7-9-14)18(24)22-15-4-1-3-13(11-15)19-23-17-16(25-19)5-2-10-21-17/h1-11H,(H,22,24) |
| InChIKey | CWIJMXCRPKYNCO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|