C26H19N3O3 — CID 1350972
N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylmethoxybenzamide (PubChem CID 1350972) has the molecular formula C26H19N3O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 1350972 |
| Molecular Formula | C26H19N3O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ncccc3o2)c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H19N3O3/c30-25(19-9-5-12-22(16-19)31-17-18-7-2-1-3-8-18)28-21-11-4-10-20(15-21)26-29-24-23(32-26)13-6-14-27-24/h1-16H,17H2,(H,28,30) |
| InChIKey | IISMSHBSKNNVFF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |