C19H12N4O4 — CID 4599218
4-nitro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 4599218) has the molecular formula C19H12N4O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 4-nitro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 4599218 |
| Molecular Formula | C19H12N4O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-nitro-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ncccc3o2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12N4O4/c24-18(12-6-8-15(9-7-12)23(25)26)21-14-4-1-3-13(11-14)19-22-17-16(27-19)5-2-10-20-17/h1-11H,(H,21,24) |
| InChIKey | YNANENPZSWKUEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|