C22H18N4O5 — CID 1007487
2-(2,4-dimethyl-6-nitrophenoxy)-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]acetamide (PubChem CID 1007487) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-nitrophenoxy)-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-(2,4-dimethyl-6-nitrophenoxy)-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 1007487 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(2,4-dimethyl-6-nitrophenoxy)-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)Nc2cccc(-c3nc4ncccc4o3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N4O5/c1-13-9-14(2)20(17(10-13)26(28)29)30-12-19(27)24-16-6-3-5-15(11-16)22-25-21-18(31-22)7-4-8-23-21/h3-11H,12H2,1-2H3,(H,24,27) |
| InChIKey | SPCPMPRSUIQOCM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|