C20H13N5O6 — CID 4184801
2-methyl-3,5-dinitro-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 4184801) has the molecular formula C20H13N5O6 and a molecular weight of 419.35 g/mol. Its IUPAC name is 2-methyl-3,5-dinitro-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 2-methyl-3,5-dinitro-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 4184801 |
| Molecular Formula | C20H13N5O6 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-methyl-3,5-dinitro-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | Cc1c(C(=O)Nc2ccc(-c3nc4ncccc4o3)cc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13N5O6/c1-11-15(9-14(24(27)28)10-16(11)25(29)30)19(26)22-13-6-4-12(5-7-13)20-23-18-17(31-20)3-2-8-21-18/h2-10H,1H3,(H,22,26) |
| InChIKey | PPQQERODFJPWKY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|