C24H16N4O6 — CID 18531150
5-(2-methoxy-4-nitrophenyl)-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide (PubChem CID 18531150) has the molecular formula C24H16N4O6 and a molecular weight of 456.41 g/mol. Its IUPAC name is 5-(2-methoxy-4-nitrophenyl)-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-methoxy-4-nitrophenyl)-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18531150 |
| Molecular Formula | C24H16N4O6 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-(2-methoxy-4-nitrophenyl)-N-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C(=O)Nc2ccc(-c3nc4ncccc4o3)cc2)o1 |
| InChI | InChI=1S/C24H16N4O6/c1-32-21-13-16(28(30)31)8-9-17(21)18-10-11-20(33-18)23(29)26-15-6-4-14(5-7-15)24-27-22-19(34-24)3-2-12-25-22/h2-13H,1H3,(H,26,29) |
| InChIKey | BZROJLCYPDRAQC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|