C24H15ClN4O5 — CID 17018462
5-(2-chloro-4-nitrophenyl)-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide (PubChem CID 17018462) has the molecular formula C24H15ClN4O5 and a molecular weight of 474.86 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17018462 |
| Molecular Formula | C24H15ClN4O5 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)cccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C24H15ClN4O5/c1-13-15(24-28-22-20(34-24)6-3-11-26-22)4-2-5-18(13)27-23(30)21-10-9-19(33-21)16-8-7-14(29(31)32)12-17(16)25/h2-12H,1H3,(H,27,30) |
| InChIKey | RPZKACSDSHMPOE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|