C20H14IN3O2 — CID 1102670
3-iodo-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 1102670) has the molecular formula C20H14IN3O2 and a molecular weight of 455.26 g/mol. Its IUPAC name is 3-iodo-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3-iodo-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1102670 |
| Molecular Formula | C20H14IN3O2 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | 3-iodo-N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | Cc1c(NC(=O)c2cccc(I)c2)cccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C20H14IN3O2/c1-12-15(20-24-18-17(26-20)9-4-10-22-18)7-3-8-16(12)23-19(25)13-5-2-6-14(21)11-13/h2-11H,1H3,(H,23,25) |
| InChIKey | KSGCAOFQZYSXPF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|