C29H19N3O4 — CID 3968758
N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide (PubChem CID 3968758) has the molecular formula C29H19N3O4 and a molecular weight of 473.49 g/mol. Its IUPAC name is N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 3968758 |
| Molecular Formula | C29H19N3O4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[2-methyl-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-4-(2-oxochromen-3-yl)benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(-c3cc4ccccc4oc3=O)cc2)cccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C29H19N3O4/c1-17-21(28-32-26-25(35-28)10-5-15-30-26)7-4-8-23(17)31-27(33)19-13-11-18(12-14-19)22-16-20-6-2-3-9-24(20)36-29(22)34/h2-16H,1H3,(H,31,33) |
| InChIKey | VEUUZZMLMOWOFT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|