C18H12N4O7 — CID 70941535
N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide (PubChem CID 70941535) has the molecular formula C18H12N4O7 and a molecular weight of 396.32 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 70941535 |
| Molecular Formula | C18H12N4O7 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C(=O)Nc2nnc(-c3ccco3)o2)o1 |
| InChI | InChI=1S/C18H12N4O7/c1-26-15-9-10(22(24)25)4-5-11(15)12-6-7-13(28-12)16(23)19-18-21-20-17(29-18)14-3-2-8-27-14/h2-9H,1H3,(H,19,21,23) |
| InChIKey | PWCGVAJLSKGVLW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|