C13H7BrN4O5 — CID 70941492
3-bromo-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-nitrobenzamide (PubChem CID 70941492) has the molecular formula C13H7BrN4O5 and a molecular weight of 379.13 g/mol. Its IUPAC name is 3-bromo-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-nitrobenzamide.
| Compound Name | 3-bromo-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 70941492 |
| Molecular Formula | C13H7BrN4O5 |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 3-bromo-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1nnc(-c2ccco2)o1)c1cc(Br)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7BrN4O5/c14-8-4-7(5-9(6-8)18(20)21)11(19)15-13-17-16-12(23-13)10-2-1-3-22-10/h1-6H,(H,15,17,19) |
| InChIKey | CNDZHPULAFCDSZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|