C21H15N3O3 — CID 89120372
3-(4-ethenylphenyl)-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 89120372) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-(4-ethenylphenyl)-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 3-(4-ethenylphenyl)-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 89120372 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-(4-ethenylphenyl)-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | C=Cc1ccc(-c2cccc(C(=O)Nc3nnc(-c4ccco4)o3)c2)cc1 |
| InChI | InChI=1S/C21H15N3O3/c1-2-14-8-10-15(11-9-14)16-5-3-6-17(13-16)19(25)22-21-24-23-20(27-21)18-7-4-12-26-18/h2-13H,1H2,(H,22,24,25) |
| InChIKey | BFJDCVGSLXJOAN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |