C20H12N4O3 — CID 177345157
3-cyano-N-[5-[3-(furan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 177345157) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-cyano-N-[5-[3-(furan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 3-cyano-N-[5-[3-(furan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 177345157 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-cyano-N-[5-[3-(furan-2-yl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2nnc(-c3cccc(-c4ccco4)c3)o2)c1 |
| InChI | InChI=1S/C20H12N4O3/c21-12-13-4-1-6-15(10-13)18(25)22-20-24-23-19(27-20)16-7-2-5-14(11-16)17-8-3-9-26-17/h1-11H,(H,22,24,25) |
| InChIKey | VNNGKLQHTUWFPS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |