C15H10N4O3 — CID 50755586
3-cyano-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]benzamide (PubChem CID 50755586) has the molecular formula C15H10N4O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 3-cyano-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]benzamide.
| Compound Name | 3-cyano-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 50755586 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-cyano-N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCc2noc(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C15H10N4O3/c16-8-10-3-1-4-11(7-10)14(20)17-9-13-18-15(22-19-13)12-5-2-6-21-12/h1-7H,9H2,(H,17,20) |
| InChIKey | MWJBESQRPFYJEY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |