C18H17N5O5 — CID 51127697
N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 51127697) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 51127697 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCc1noc(-c2ccco2)n1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N5O5/c24-17(19-11-16-20-18(28-21-16)15-4-3-9-27-15)12-5-6-13(14(10-12)23(25)26)22-7-1-2-8-22/h3-6,9-10H,1-2,7-8,11H2,(H,19,24) |
| InChIKey | PQBNCFUNJUWMQC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|