C23H22ClN3O4 — CID 54858282
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 54858282) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 54858282 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Cl)cc2)o1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22ClN3O4/c24-18-7-4-16(5-8-18)22-11-9-19(31-22)15-25-23(28)17-6-10-20(21(14-17)27(29)30)26-12-2-1-3-13-26/h4-11,14H,1-3,12-13,15H2,(H,25,28) |
| InChIKey | OKYZYSQJPVMABN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|