C23H27ClN4O4 — CID 60597261
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 60597261) has the molecular formula C23H27ClN4O4 and a molecular weight of 458.95 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 60597261 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCOCC1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27ClN4O4/c24-19-6-3-17(4-7-19)22(27-11-13-32-14-12-27)16-25-23(29)18-5-8-20(21(15-18)28(30)31)26-9-1-2-10-26/h3-8,15,22H,1-2,9-14,16H2,(H,25,29) |
| InChIKey | NWEJVUZCPFGMNM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|