C20H19ClF4N2O2 — CID 60596930
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 60596930) has the molecular formula C20H19ClF4N2O2 and a molecular weight of 430.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 60596930 |
| Molecular Formula | C20H19ClF4N2O2 |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCOCC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19ClF4N2O2/c21-15-4-1-13(2-5-15)18(27-7-9-29-10-8-27)12-26-19(28)14-3-6-17(22)16(11-14)20(23,24)25/h1-6,11,18H,7-10,12H2,(H,26,28) |
| InChIKey | QJMRYUFGFKZVPN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |