C20H20F4N2O3 — CID 43003559
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 43003559) has the molecular formula C20H20F4N2O3 and a molecular weight of 412.38 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 43003559 |
| Molecular Formula | C20H20F4N2O3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)N1CCOCC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F4N2O3/c21-16-5-1-14(2-6-16)18(26-9-11-28-12-10-26)13-25-19(27)15-3-7-17(8-4-15)29-20(22,23)24/h1-8,18H,9-13H2,(H,25,27) |
| InChIKey | QOGAYVKEIHTPHW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |