C21H22F4N2O3 — CID 47040388
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 47040388) has the molecular formula C21H22F4N2O3 and a molecular weight of 426.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 47040388 |
| Molecular Formula | C21H22F4N2O3 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H22F4N2O3/c22-17-5-3-16(4-6-17)19(27-9-11-29-12-10-27)14-26-20(28)13-15-1-7-18(8-2-15)30-21(23,24)25/h1-8,19H,9-14H2,(H,26,28) |
| InChIKey | FIFRBXCMXRXTNL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |