C19H19ClF2N2O2 — CID 17460307
5-chloro-2-fluoro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 17460307) has the molecular formula C19H19ClF2N2O2 and a molecular weight of 380.82 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 17460307 |
| Molecular Formula | C19H19ClF2N2O2 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-chloro-2-fluoro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)N1CCOCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C19H19ClF2N2O2/c20-14-3-6-17(22)16(11-14)19(25)23-12-18(24-7-9-26-10-8-24)13-1-4-15(21)5-2-13/h1-6,11,18H,7-10,12H2,(H,23,25) |
| InChIKey | SVABBAPFMPQZBJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |