C19H21ClFN3O2 — CID 30834737
1-(3-chlorophenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea (PubChem CID 30834737) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 30834737 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea |
| SMILES | O=C(NC[C@H](c1ccc(F)cc1)N1CCOCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClFN3O2/c20-15-2-1-3-17(12-15)23-19(25)22-13-18(24-8-10-26-11-9-24)14-4-6-16(21)7-5-14/h1-7,12,18H,8-11,13H2,(H2,22,23,25)/t18-/m1/s1 |
| InChIKey | DPKXQEADCOMYHR-GOSISDBHSA-N |
| XLogP | 3.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |