C21H25ClFN3O2 — CID 42928186
1-[2-(4-chlorophenyl)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea (PubChem CID 42928186) has the molecular formula C21H25ClFN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 42928186 |
| Molecular Formula | C21H25ClFN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]urea |
| SMILES | O=C(NCCc1ccc(Cl)cc1)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H25ClFN3O2/c22-18-5-1-16(2-6-18)9-10-24-21(27)25-15-20(26-11-13-28-14-12-26)17-3-7-19(23)8-4-17/h1-8,20H,9-15H2,(H2,24,25,27) |
| InChIKey | WQSOSUIXHJLIFL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |