C20H24FN3O2 — CID 42890407
1-[(4-fluorophenyl)methyl]-3-(2-morpholin-4-yl-2-phenylethyl)urea (PubChem CID 42890407) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2-morpholin-4-yl-2-phenylethyl)urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2-morpholin-4-yl-2-phenylethyl)urea |
|---|---|
| PubChem CID | 42890407 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2-morpholin-4-yl-2-phenylethyl)urea |
| SMILES | O=C(NCc1ccc(F)cc1)NCC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H24FN3O2/c21-18-8-6-16(7-9-18)14-22-20(25)23-15-19(17-4-2-1-3-5-17)24-10-12-26-13-11-24/h1-9,19H,10-15H2,(H2,22,23,25) |
| InChIKey | HQBYAAZBLVYVBQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |