C22H26FN3O4 — CID 30835452
N'-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 30835452) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is N'-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 30835452 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N'-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NC[C@H](c2ccc(F)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26FN3O4/c1-29-19-8-2-16(3-9-19)14-24-21(27)22(28)25-15-20(26-10-12-30-13-11-26)17-4-6-18(23)7-5-17/h2-9,20H,10-15H2,1H3,(H,24,27)(H,25,28)/t20-/m1/s1 |
| InChIKey | XCUCWXXJIJQEFO-HXUWFJFHSA-N |
| XLogP | 1.64 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|