C22H24F2N2O4 — CID 158930249
3-(3,4-difluorophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-oxopropanamide (PubChem CID 158930249) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-oxopropanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 158930249 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-oxopropanamide |
| SMILES | COc1ccc(C(CNC(=O)C(=O)Cc2ccc(F)c(F)c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H24F2N2O4/c1-29-17-5-3-16(4-6-17)20(26-8-10-30-11-9-26)14-25-22(28)21(27)13-15-2-7-18(23)19(24)12-15/h2-7,12,20H,8-11,13-14H2,1H3,(H,25,28) |
| InChIKey | PMGSDTZPRIPNAH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|