C20H22ClFN2O3 — CID 4790233
5-chloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methoxybenzamide (PubChem CID 4790233) has the molecular formula C20H22ClFN2O3 and a molecular weight of 392.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4790233 |
| Molecular Formula | C20H22ClFN2O3 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-chloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22ClFN2O3/c1-26-19-7-4-15(21)12-17(19)20(25)23-13-18(24-8-10-27-11-9-24)14-2-5-16(22)6-3-14/h2-7,12,18H,8-11,13H2,1H3,(H,23,25) |
| InChIKey | QZNCUCQAZCLEBC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |