C17H25N3O4 — CID 95775169
N-[(2R,4S)-4-hydroxy-2-methylpentyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 95775169) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(2R,4S)-4-hydroxy-2-methylpentyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(2R,4S)-4-hydroxy-2-methylpentyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 95775169 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(2R,4S)-4-hydroxy-2-methylpentyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | C[C@@H](CNC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)C[C@H](C)O |
| InChI | InChI=1S/C17H25N3O4/c1-12(9-13(2)21)11-18-17(22)14-5-6-15(16(10-14)20(23)24)19-7-3-4-8-19/h5-6,10,12-13,21H,3-4,7-9,11H2,1-2H3,(H,18,22)/t12-,13+/m1/s1 |
| InChIKey | IAGTWIQUJILKRJ-OLZOCXBDSA-N |
| XLogP | 2.33 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|